C17H26N2O7S — CID 135056081
[(5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate (PubChem CID 135056081) has the molecular formula C17H26N2O7S and a molecular weight of 402.47 g/mol. Its IUPAC name is [(5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate.
| Compound Name | [(5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate |
|---|---|
| PubChem CID | 135056081 |
| Molecular Formula | C17H26N2O7S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)C(CCCOS(C)(=O)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O7S/c1-17(2,3)26-16(20)18-15(13-9-6-5-7-10-13)14(19(21)22)11-8-12-25-27(4,23)24/h5-7,9-10,14-15H,8,11-12H2,1-4H3,(H,18,20)/t14?,15-/m1/s1 |
| InChIKey | YVUFTTVRGBZBGZ-YSSOQSIOSA-N |
| XLogP | 2.65 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|