C17H27NO5S — CID 59755691
[(4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] methanesulfonate (PubChem CID 59755691) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is [(4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] methanesulfonate.
| Compound Name | [(4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 59755691 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(C)(C)OS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C17H27NO5S/c1-16(2,3)22-15(19)18-14(13-10-8-7-9-11-13)12-17(4,5)23-24(6,20)21/h7-11,14H,12H2,1-6H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | UQTFNWNDNUIXMU-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|