C31H56N2O5S — CID 71659092
(E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium (PubChem CID 71659092) has the molecular formula C31H56N2O5S and a molecular weight of 568.87 g/mol. Its IUPAC name is (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium.
| Compound Name | (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 71659092 |
| Molecular Formula | C31H56N2O5S |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.39 |
| IUPAC Name | (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)[O-])Cc1ccccc1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C15H21NO5S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-15(2,3)21-14(17)16-13(9-10-22(18,19)20)11-12-7-5-4-6-8-12/h5-16H2,1-4H3;4-10,13H,11H2,1-3H3,(H,16,17)(H,18,19,20)/q+1;/p-1/b;10-9+/t;13-/m.1/s1 |
| InChIKey | XBGOAPMTKARDHH-XMHKMJDWSA-M |
| XLogP | 7.18 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|