C17H25NO5S — CID 71659091
ethyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate (PubChem CID 71659091) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is ethyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate.
| Compound Name | ethyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate |
|---|---|
| PubChem CID | 71659091 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | ethyl (E,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-1-ene-1-sulfonate |
| SMILES | CCOS(=O)(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO5S/c1-5-22-24(20,21)12-11-15(13-14-9-7-6-8-10-14)18-16(19)23-17(2,3)4/h6-12,15H,5,13H2,1-4H3,(H,18,19)/b12-11+/t15-/m1/s1 |
| InChIKey | KEHAJIGTQHDQRY-AYJWMTRPSA-N |
| XLogP | 3.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|