C14H19NO4S — CID 71659094
ethyl (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate (PubChem CID 71659094) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate.
| Compound Name | ethyl (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate |
|---|---|
| PubChem CID | 71659094 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate |
| SMILES | CCOS(=O)(=O)/C=C/[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C14H19NO4S/c1-3-19-20(17,18)10-9-14(15-12(2)16)11-13-7-5-4-6-8-13/h4-10,14H,3,11H2,1-2H3,(H,15,16)/b10-9+/t14-/m1/s1 |
| InChIKey | PADINZDKNRSYIG-ATWMFIQVSA-N |
| XLogP | 1.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|