C28H50N2O4S — CID 71659095
(E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium (PubChem CID 71659095) has the molecular formula C28H50N2O4S and a molecular weight of 510.79 g/mol. Its IUPAC name is (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium.
| Compound Name | (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 71659095 |
| Molecular Formula | C28H50N2O4S |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | (E,3S)-3-acetamido-4-phenylbut-1-ene-1-sulfonate;tetrabutylazanium |
| SMILES | CC(=O)N[C@H](/C=C/S(=O)(=O)[O-])Cc1ccccc1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C12H15NO4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-10(14)13-12(7-8-18(15,16)17)9-11-5-3-2-4-6-11/h5-16H2,1-4H3;2-8,12H,9H2,1H3,(H,13,14)(H,15,16,17)/q+1;/p-1/b;8-7+/t;12-/m.1/s1 |
| InChIKey | LYPZRHYWCGPFGC-ZXPVRRLESA-M |
| XLogP | 5.80 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|