C32H42N2O4Si — CID 15441178
(2R,3R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butan-1-imine oxide (PubChem CID 15441178) has the molecular formula C32H42N2O4Si and a molecular weight of 546.78 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butan-1-imine oxide.
| Compound Name | (2R,3R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butan-1-imine oxide |
|---|---|
| PubChem CID | 15441178 |
| Molecular Formula | C32H42N2O4Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | (2R,3R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butan-1-imine oxide |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](/C=[N+](\[O-])Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42N2O4Si/c1-25(29(33-30(35)37-31(2,3)4)24-34(36)23-26-17-11-8-12-18-26)38-39(32(5,6)7,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,24-25,29H,23H2,1-7H3,(H,33,35)/b34-24-/t25-,29-/m1/s1 |
| InChIKey | KHJUABOORAGILL-CLYGALLSSA-N |
| XLogP | 5.63 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|