C31H40N2O4Si — CID 56954080
(2R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-1-imine oxide (PubChem CID 56954080) has the molecular formula C31H40N2O4Si and a molecular weight of 532.76 g/mol. Its IUPAC name is (2R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-1-imine oxide.
| Compound Name | (2R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-1-imine oxide |
|---|---|
| PubChem CID | 56954080 |
| Molecular Formula | C31H40N2O4Si |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (2R)-N-benzyl-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-1-imine oxide |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=[N+](/[O-])Cc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H40N2O4Si/c1-30(2,3)37-29(34)32-26(23-33(35)22-25-16-10-7-11-17-25)24-36-38(31(4,5)6,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,23,26H,22,24H2,1-6H3,(H,32,34)/b33-23+/t26-/m1/s1 |
| InChIKey | PFOVZAHZDXGBNN-NGDXGOMLSA-N |
| XLogP | 5.24 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|