C33H42N2O4Si — CID 11734396
N-benzyl-1-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide (PubChem CID 11734396) has the molecular formula C33H42N2O4Si and a molecular weight of 558.80 g/mol. Its IUPAC name is N-benzyl-1-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide |
|---|---|
| PubChem CID | 11734396 |
| Molecular Formula | C33H42N2O4Si |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | N-benzyl-1-[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methanimine oxide |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C33H42N2O4Si/c1-32(2,3)38-31(36)35-25-28(22-27(35)24-34(37)23-26-16-10-7-11-17-26)39-40(33(4,5)6,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,24,27-28H,22-23,25H2,1-6H3/b34-24-/t27-,28+/m0/s1 |
| InChIKey | LMSNBRMQQKVXGO-HAOPSMAVSA-N |
| XLogP | 5.72 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|