C38H52N2O4Si2 — CID 100985162
tert-butyl (2S,4R)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 100985162) has the molecular formula C38H52N2O4Si2 and a molecular weight of 657.02 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100985162 |
| Molecular Formula | C38H52N2O4Si2 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.35 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(1R)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1[C@@H](C#C[Si](C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C38H52N2O4Si2/c1-37(2,3)43-36(41)39-29-31(27-35(39)34(25-26-45(7,8)9)40(42)28-30-19-13-10-14-20-30)44-46(38(4,5)6,32-21-15-11-16-22-32)33-23-17-12-18-24-33/h10-24,31,34-35,42H,27-29H2,1-9H3/t31-,34-,35+/m1/s1 |
| InChIKey | ZIOLMKNGLDSSOV-KZXHCJOXSA-N |
| XLogP | 7.08 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|