C33H44N2O4Si — CID 11028129
tert-butyl N-[(2S,3R)-4-benzylimino-1-[tert-butyl(diphenyl)silyl]oxy-3-methoxybutan-2-yl]carbamate (PubChem CID 11028129) has the molecular formula C33H44N2O4Si and a molecular weight of 560.81 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-benzylimino-1-[tert-butyl(diphenyl)silyl]oxy-3-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-benzylimino-1-[tert-butyl(diphenyl)silyl]oxy-3-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11028129 |
| Molecular Formula | C33H44N2O4Si |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-benzylimino-1-[tert-butyl(diphenyl)silyl]oxy-3-methoxybutan-2-yl]carbamate |
| SMILES | CO[C@@H](/C=N/Cc1ccccc1)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H44N2O4Si/c1-32(2,3)39-31(36)35-29(30(37-7)24-34-23-26-17-11-8-12-18-26)25-38-40(33(4,5)6,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,24,29-30H,23,25H2,1-7H3,(H,35,36)/b34-24+/t29-,30-/m0/s1 |
| InChIKey | SNUYEIAAZWRGRG-JSZLSQPFSA-N |
| XLogP | 5.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|