C34H46N2O3Si — CID 10650482
tert-butyl N-[(2R,3R,4S)-4-(benzylamino)-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate (PubChem CID 10650482) has the molecular formula C34H46N2O3Si and a molecular weight of 558.84 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4S)-4-(benzylamino)-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4S)-4-(benzylamino)-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10650482 |
| Molecular Formula | C34H46N2O3Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | tert-butyl N-[(2R,3R,4S)-4-(benzylamino)-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate |
| SMILES | C=C[C@H](NCc1ccccc1)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46N2O3Si/c1-9-30(35-25-27-19-13-10-14-20-27)31(36-32(37)38-33(3,4)5)26(2)39-40(34(6,7)8,28-21-15-11-16-22-28)29-23-17-12-18-24-29/h9-24,26,30-31,35H,1,25H2,2-8H3,(H,36,37)/t26-,30+,31+/m1/s1 |
| InChIKey | PYKZILNNOWZZNV-JZRGNDHQSA-N |
| XLogP | 6.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|