C28H41FN2O3Si — CID 69176187
[2-benzyl-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N-benzylcarbamate (PubChem CID 69176187) has the molecular formula C28H41FN2O3Si and a molecular weight of 500.73 g/mol. Its IUPAC name is [2-benzyl-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N-benzylcarbamate.
| Compound Name | [2-benzyl-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 69176187 |
| Molecular Formula | C28H41FN2O3Si |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | [2-benzyl-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N-benzylcarbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CCC(OC(=O)NCc2ccccc2)C(F)C1Cc1ccccc1 |
| InChI | InChI=1S/C28H41FN2O3Si/c1-28(2,3)35(4,5)33-19-18-31-17-16-25(26(29)24(31)20-22-12-8-6-9-13-22)34-27(32)30-21-23-14-10-7-11-15-23/h6-15,24-26H,16-21H2,1-5H3,(H,30,32) |
| InChIKey | HYNFBCAESQAHDC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|