C28H41FN2O3Si — CID 91536914
[(3S,4S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N,N-dibenzylcarbamate (PubChem CID 91536914) has the molecular formula C28H41FN2O3Si and a molecular weight of 500.73 g/mol. Its IUPAC name is [(3S,4S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N,N-dibenzylcarbamate.
| Compound Name | [(3S,4S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N,N-dibenzylcarbamate |
|---|---|
| PubChem CID | 91536914 |
| Molecular Formula | C28H41FN2O3Si |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | [(3S,4S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl] N,N-dibenzylcarbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CC[C@H](OC(=O)N(Cc2ccccc2)Cc2ccccc2)[C@@H](F)C1 |
| InChI | InChI=1S/C28H41FN2O3Si/c1-28(2,3)35(4,5)33-19-18-30-17-16-26(25(29)22-30)34-27(32)31(20-23-12-8-6-9-13-23)21-24-14-10-7-11-15-24/h6-15,25-26H,16-22H2,1-5H3/t25-,26-/m0/s1 |
| InChIKey | YIEQPQPLGAXAPY-UIOOFZCWSA-N |
| XLogP | 6.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|