C40H60N2O6Si2 — CID 10580726
methyl (3R,4R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10580726) has the molecular formula C40H60N2O6Si2 and a molecular weight of 721.10 g/mol. Its IUPAC name is methyl (3R,4R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (3R,4R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10580726 |
| Molecular Formula | C40H60N2O6Si2 |
| Molecular Weight | 721.10 g/mol |
| Exact Mass | 720.40 |
| IUPAC Name | methyl (3R,4R)-3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)C[C@H]([C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H60N2O6Si2/c1-38(2,3)47-37(44)41-34(30-46-50(40(7,8)9,32-24-18-14-19-25-32)33-26-20-15-21-27-33)35(28-36(43)45-10)42(29-31-22-16-13-17-23-31)48-49(11,12)39(4,5)6/h13-27,34-35H,28-30H2,1-12H3,(H,41,44)/t34-,35+/m0/s1 |
| InChIKey | ZDSDFVPMYRGNPL-OIDHKYIRSA-N |
| XLogP | 7.83 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.10 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|