C34H46N2O6Si — CID 10531754
methyl (3R,4R)-3-[benzyl(hydroxy)amino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10531754) has the molecular formula C34H46N2O6Si and a molecular weight of 606.84 g/mol. Its IUPAC name is methyl (3R,4R)-3-[benzyl(hydroxy)amino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (3R,4R)-3-[benzyl(hydroxy)amino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10531754 |
| Molecular Formula | C34H46N2O6Si |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | methyl (3R,4R)-3-[benzyl(hydroxy)amino]-5-[tert-butyl(diphenyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)C[C@H]([C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C34H46N2O6Si/c1-33(2,3)42-32(38)35-29(30(23-31(37)40-7)36(39)24-26-17-11-8-12-18-26)25-41-43(34(4,5)6,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,29-30,39H,23-25H2,1-7H3,(H,35,38)/t29-,30+/m0/s1 |
| InChIKey | QVYDZXQXPRTQKB-XZWHSSHBSA-N |
| XLogP | 5.28 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|