C34H46N2O4Si — CID 10531210
tert-butyl N-[(2R,3R,4S)-4-[benzyl(hydroxy)amino]-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate (PubChem CID 10531210) has the molecular formula C34H46N2O4Si and a molecular weight of 574.84 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4S)-4-[benzyl(hydroxy)amino]-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4S)-4-[benzyl(hydroxy)amino]-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10531210 |
| Molecular Formula | C34H46N2O4Si |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | tert-butyl N-[(2R,3R,4S)-4-[benzyl(hydroxy)amino]-2-[tert-butyl(diphenyl)silyl]oxyhex-5-en-3-yl]carbamate |
| SMILES | C=C[C@@H]([C@@H](NC(=O)OC(C)(C)C)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C34H46N2O4Si/c1-9-30(36(38)25-27-19-13-10-14-20-27)31(35-32(37)39-33(3,4)5)26(2)40-41(34(6,7)8,28-21-15-11-16-22-28)29-23-17-12-18-24-29/h9-24,26,30-31,38H,1,25H2,2-8H3,(H,35,37)/t26-,30+,31+/m1/s1 |
| InChIKey | VSNZSURHDMVVQH-JZRGNDHQSA-N |
| XLogP | 6.29 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|