C27H46N2O6Si — CID 101082438
tert-butyl (4R)-4-[(1S)-1-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101082438) has the molecular formula C27H46N2O6Si and a molecular weight of 522.76 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S)-1-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S)-1-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101082438 |
| Molecular Formula | C27H46N2O6Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | tert-butyl (4R)-4-[(1S)-1-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)C[C@@H]([C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46N2O6Si/c1-25(2,3)34-24(31)29-22(19-33-27(29,7)8)21(17-23(30)32-9)28(18-20-15-13-12-14-16-20)35-36(10,11)26(4,5)6/h12-16,21-22H,17-19H2,1-11H3/t21-,22-/m0/s1 |
| InChIKey | HMWNQIFWTWUNBD-VXKWHMMOSA-N |
| XLogP | 5.73 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|