C22H32N2O5 — CID 10811222
tert-butyl (4R)-4-[(2S,3S)-1-benzyl-3-ethoxycarbonylaziridin-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10811222) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(2S,3S)-1-benzyl-3-ethoxycarbonylaziridin-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(2S,3S)-1-benzyl-3-ethoxycarbonylaziridin-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10811222 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | tert-butyl (4R)-4-[(2S,3S)-1-benzyl-3-ethoxycarbonylaziridin-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]([C@@H]2COC(C)(C)N2C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O5/c1-7-27-19(25)18-17(23(18)13-15-11-9-8-10-12-15)16-14-28-22(5,6)24(16)20(26)29-21(2,3)4/h8-12,16-18H,7,13-14H2,1-6H3/t16-,17-,18-,23?/m0/s1 |
| InChIKey | QMYRHDTWCFFXNM-MZINHIKLSA-N |
| XLogP | 3.17 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|