C23H34N2O6 — CID 22369477
diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-phenylethyl)pyrrolidine-2,4-dicarboxylate (PubChem CID 22369477) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-phenylethyl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-phenylethyl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 22369477 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-phenylethyl)pyrrolidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1CC(NC(=O)OC(C)(C)C)(C(=O)OCC)CN1CCc1ccccc1 |
| InChI | InChI=1S/C23H34N2O6/c1-6-29-19(26)18-15-23(20(27)30-7-2,24-21(28)31-22(3,4)5)16-25(18)14-13-17-11-9-8-10-12-17/h8-12,18H,6-7,13-16H2,1-5H3,(H,24,28) |
| InChIKey | DEKKHEDPSOCISR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|