C23H36N2O4Si — CID 134927354
tert-butyl (4S)-4-[(1S)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134927354) has the molecular formula C23H36N2O4Si and a molecular weight of 432.64 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134927354 |
| Molecular Formula | C23H36N2O4Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl (4S)-4-[(1S)-1-[benzyl(hydroxy)amino]-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](C#C[Si](C)(C)C)N(O)Cc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C23H36N2O4Si/c1-22(2,3)29-21(26)25-20(17-28-23(25,4)5)19(14-15-30(6,7)8)24(27)16-18-12-10-9-11-13-18/h9-13,19-20,27H,16-17H2,1-8H3/t19-,20+/m0/s1 |
| InChIKey | MIPVHCPNUPFCNJ-VQTJNVASSA-N |
| XLogP | 4.50 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|