C23H36N2O3Si — CID 10960709
tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10960709) has the molecular formula C23H36N2O3Si and a molecular weight of 416.64 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10960709 |
| Molecular Formula | C23H36N2O3Si |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | tert-butyl (4R)-4-[(1S)-1-(benzylamino)-3-trimethylsilylprop-2-ynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](C#C[Si](C)(C)C)NCc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C23H36N2O3Si/c1-22(2,3)28-21(26)25-20(17-27-23(25,4)5)19(14-15-29(6,7)8)24-16-18-12-10-9-11-13-18/h9-13,19-20,24H,16-17H2,1-8H3/t19-,20-/m0/s1 |
| InChIKey | QRXLCGNXLGOMBA-PMACEKPBSA-N |
| XLogP | 4.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|