C32H44N2O3Si — CID 131733853
tert-butyl N-[(2S)-4-(benzylamino)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate (PubChem CID 131733853) has the molecular formula C32H44N2O3Si and a molecular weight of 532.80 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(benzylamino)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-(benzylamino)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 131733853 |
| Molecular Formula | C32H44N2O3Si |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | tert-butyl N-[(2S)-4-(benzylamino)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCNCc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H44N2O3Si/c1-31(2,3)37-30(35)34-27(22-23-33-24-26-16-10-7-11-17-26)25-36-38(32(4,5)6,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,27,33H,22-25H2,1-6H3,(H,34,35)/t27-/m0/s1 |
| InChIKey | FGNTVWYYQSGFEL-MHZLTWQESA-N |
| XLogP | 5.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|