C27H33NO2Si — CID 154721486
tert-butyl N-[(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl]carbamate (PubChem CID 154721486) has the molecular formula C27H33NO2Si and a molecular weight of 431.65 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl]carbamate |
|---|---|
| PubChem CID | 154721486 |
| Molecular Formula | C27H33NO2Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-[dimethyl(phenyl)silyl]-1,2-diphenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@H](c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H33NO2Si/c1-27(2,3)30-26(29)28-24(21-15-9-6-10-16-21)25(22-17-11-7-12-18-22)31(4,5)23-19-13-8-14-20-23/h6-20,24-25H,1-5H3,(H,28,29)/t24-,25+/m1/s1 |
| InChIKey | LCRAEAWPVXXRQP-RPBOFIJWSA-N |
| XLogP | 6.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|