C23H25NO9 — CID 134866867
[(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]octa-4,6-dienyl] acetate (PubChem CID 134866867) has the molecular formula C23H25NO9 and a molecular weight of 459.45 g/mol. Its IUPAC name is [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]octa-4,6-dienyl] acetate.
| Compound Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]octa-4,6-dienyl] acetate |
|---|---|
| PubChem CID | 134866867 |
| Molecular Formula | C23H25NO9 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [(2R,3S,4E,6E)-2,3-diacetyloxy-8-oxo-8-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]octa-4,6-dienyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](/C=C/C=C/C(=O)N1C(=O)OC[C@H]1c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C23H25NO9/c1-15(25)30-14-21(33-17(3)27)20(32-16(2)26)11-7-8-12-22(28)24-19(13-31-23(24)29)18-9-5-4-6-10-18/h4-12,19-21H,13-14H2,1-3H3/b11-7+,12-8+/t19-,20-,21+/m0/s1 |
| InChIKey | FYFXYMIIEBGIOY-QEZNLGBQSA-N |
| XLogP | 2.25 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|