C15H17NO3 — CID 71697478
(2R)-2-[(S)-hydroxy-[(2R)-1-[(1S)-1-phenylethyl]aziridin-2-yl]methyl]-2H-furan-5-one (PubChem CID 71697478) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2R)-2-[(S)-hydroxy-[(2R)-1-[(1S)-1-phenylethyl]aziridin-2-yl]methyl]-2H-furan-5-one.
| Compound Name | (2R)-2-[(S)-hydroxy-[(2R)-1-[(1S)-1-phenylethyl]aziridin-2-yl]methyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 71697478 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R)-2-[(S)-hydroxy-[(2R)-1-[(1S)-1-phenylethyl]aziridin-2-yl]methyl]-2H-furan-5-one |
| SMILES | C[C@@H](c1ccccc1)N1C[C@@H]1[C@H](O)[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C15H17NO3/c1-10(11-5-3-2-4-6-11)16-9-12(16)15(18)13-7-8-14(17)19-13/h2-8,10,12-13,15,18H,9H2,1H3/t10-,12+,13+,15-,16?/m0/s1 |
| InChIKey | BOHCYEMERINRBX-FVZLBROTSA-N |
| XLogP | 1.27 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|