C21H18F2O4 — CID 122218940
ethyl 2,2-difluoro-2-[6-methyl-4-(4-methylphenyl)-2-oxochromen-3-yl]acetate (PubChem CID 122218940) has the molecular formula C21H18F2O4 and a molecular weight of 372.37 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[6-methyl-4-(4-methylphenyl)-2-oxochromen-3-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[6-methyl-4-(4-methylphenyl)-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 122218940 |
| Molecular Formula | C21H18F2O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | ethyl 2,2-difluoro-2-[6-methyl-4-(4-methylphenyl)-2-oxochromen-3-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)c1c(-c2ccc(C)cc2)c2cc(C)ccc2oc1=O |
| InChI | InChI=1S/C21H18F2O4/c1-4-26-20(25)21(22,23)18-17(14-8-5-12(2)6-9-14)15-11-13(3)7-10-16(15)27-19(18)24/h5-11H,4H2,1-3H3 |
| InChIKey | JSLASTVEBYERDU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|