C13H17F2O3P — CID 58660615
ethyl 2-[2,4-dimethyl-6-(phosphanyloxymethyl)phenyl]-2,2-difluoroacetate (PubChem CID 58660615) has the molecular formula C13H17F2O3P and a molecular weight of 290.25 g/mol. Its IUPAC name is ethyl 2-[2,4-dimethyl-6-(phosphanyloxymethyl)phenyl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[2,4-dimethyl-6-(phosphanyloxymethyl)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 58660615 |
| Molecular Formula | C13H17F2O3P |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | ethyl 2-[2,4-dimethyl-6-(phosphanyloxymethyl)phenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1c(C)cc(C)cc1COP |
| InChI | InChI=1S/C13H17F2O3P/c1-4-17-12(16)13(14,15)11-9(3)5-8(2)6-10(11)7-18-19/h5-6H,4,7,19H2,1-3H3 |
| InChIKey | DKZQSKQCEJMQPF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|