About [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol
[3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol (PubChem CID 171016775) has the molecular formula C10H11F3O
and a molecular weight of 204.19 g/mol. Its IUPAC name is [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 171016775 |
| Molecular Formula | C10H11F3O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1cc(C)c(C(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C10H11F3O/c1-6-3-7(2)9(10(11,12)13)8(4-6)5-14/h3-4,14H,5H2,1-2H3 |
| InChIKey | IZOHLAFBUPJTTJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol?
The IUPAC name of [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol (CID 171016775) is [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol is Cc1cc(C)c(C(F)(F)F)c(CO)c1.
What is the InChIKey of [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol?
The InChIKey is IZOHLAFBUPJTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3O/c1-6-3-7(2)9(10(11,12)13)8(4-6)5-14/h3-4,14H,5H2,1-2H3.
What are the key properties of [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol?
[3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol has a molecular weight of 204.19 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 171016775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).