C10H11F3O — CID 171016775
[3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol (PubChem CID 171016775) has the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. Its IUPAC name is [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol.
| Compound Name | [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 171016775 |
| Molecular Formula | C10H11F3O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | [3,5-dimethyl-2-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1cc(C)c(C(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C10H11F3O/c1-6-3-7(2)9(10(11,12)13)8(4-6)5-14/h3-4,14H,5H2,1-2H3 |
| InChIKey | IZOHLAFBUPJTTJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |