C17H26O6 — CID 122219239
diethyl 2-(2-methylpropanoyl)-5-propan-2-yl-3H-furan-2,4-dicarboxylate (PubChem CID 122219239) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is diethyl 2-(2-methylpropanoyl)-5-propan-2-yl-3H-furan-2,4-dicarboxylate.
| Compound Name | diethyl 2-(2-methylpropanoyl)-5-propan-2-yl-3H-furan-2,4-dicarboxylate |
|---|---|
| PubChem CID | 122219239 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | diethyl 2-(2-methylpropanoyl)-5-propan-2-yl-3H-furan-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(C)C)OC(C(=O)OCC)(C(=O)C(C)C)C1 |
| InChI | InChI=1S/C17H26O6/c1-7-21-15(19)12-9-17(14(18)11(5)6,16(20)22-8-2)23-13(12)10(3)4/h10-11H,7-9H2,1-6H3 |
| InChIKey | PXWZDJOOUZMHLF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|