C27H25NO4 — CID 122220498
2-[(1R,2R,3S)-2-(4-methylbenzoyl)-3-(nitromethyl)-2,3-dihydro-1H-inden-1-yl]-1-(4-methylphenyl)ethanone (PubChem CID 122220498) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[(1R,2R,3S)-2-(4-methylbenzoyl)-3-(nitromethyl)-2,3-dihydro-1H-inden-1-yl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[(1R,2R,3S)-2-(4-methylbenzoyl)-3-(nitromethyl)-2,3-dihydro-1H-inden-1-yl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 122220498 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[(1R,2R,3S)-2-(4-methylbenzoyl)-3-(nitromethyl)-2,3-dihydro-1H-inden-1-yl]-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[C@H]2c3ccccc3[C@@H](C[N+](=O)[O-])[C@@H]2C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-17-7-11-19(12-8-17)25(29)15-23-21-5-3-4-6-22(21)24(16-28(31)32)26(23)27(30)20-13-9-18(2)10-14-20/h3-14,23-24,26H,15-16H2,1-2H3/t23-,24+,26+/m0/s1 |
| InChIKey | VPCWYUXWTMGXGM-BFLUCZKCSA-N |
| XLogP | 5.53 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|