C21H23IN2O2 — CID 122222049
methyl (1R,12R,19S)-12-ethyl-4-iodo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate (PubChem CID 122222049) has the molecular formula C21H23IN2O2 and a molecular weight of 462.33 g/mol. Its IUPAC name is methyl (1R,12R,19S)-12-ethyl-4-iodo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate.
| Compound Name | methyl (1R,12R,19S)-12-ethyl-4-iodo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 122222049 |
| Molecular Formula | C21H23IN2O2 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | methyl (1R,12R,19S)-12-ethyl-4-iodo-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@]4(C(=C(C(=O)OC)C1)Nc1ccc(I)cc14)[C@@H]32 |
| InChI | InChI=1S/C21H23IN2O2/c1-3-20-7-4-9-24-10-8-21(19(20)24)15-11-13(22)5-6-16(15)23-17(21)14(12-20)18(25)26-2/h4-7,11,19,23H,3,8-10,12H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | SMHUJNFKFFRECL-ACRUOGEOSA-N |
| XLogP | 3.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|