C29H28N2O2 — CID 122222056
methyl (1R,12R,19S)-12-ethyl-4-(2-phenylethynyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate (PubChem CID 122222056) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is methyl (1R,12R,19S)-12-ethyl-4-(2-phenylethynyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate.
| Compound Name | methyl (1R,12R,19S)-12-ethyl-4-(2-phenylethynyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
|---|---|
| PubChem CID | 122222056 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl (1R,12R,19S)-12-ethyl-4-(2-phenylethynyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9,13-pentaene-10-carboxylate |
| SMILES | CC[C@]12C=CCN3CC[C@]4(C(=C(C(=O)OC)C1)Nc1ccc(C#Cc5ccccc5)cc14)[C@@H]32 |
| InChI | InChI=1S/C29H28N2O2/c1-3-28-14-7-16-31-17-15-29(27(28)31)23-18-21(11-10-20-8-5-4-6-9-20)12-13-24(23)30-25(29)22(19-28)26(32)33-2/h4-9,12-14,18,27,30H,3,15-17,19H2,1-2H3/t27-,28-,29-/m0/s1 |
| InChIKey | ZRGGZOVXVSOFGO-AWCRTANDSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|