C25H19N3O2 — CID 122224135
15,21-dimethoxy-9,18-diazahexacyclo[12.11.0.02,11.03,8.017,25.019,24]pentacosa-1(25),2(11),3,5,7,9,12,14,16,19(24),20,22-dodecaen-10-amine (PubChem CID 122224135) has the molecular formula C25H19N3O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 15,21-dimethoxy-9,18-diazahexacyclo[12.11.0.02,11.03,8.017,25.019,24]pentacosa-1(25),2(11),3,5,7,9,12,14,16,19(24),20,22-dodecaen-10-amine.
| Compound Name | 15,21-dimethoxy-9,18-diazahexacyclo[12.11.0.02,11.03,8.017,25.019,24]pentacosa-1(25),2(11),3,5,7,9,12,14,16,19(24),20,22-dodecaen-10-amine |
|---|---|
| PubChem CID | 122224135 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 15,21-dimethoxy-9,18-diazahexacyclo[12.11.0.02,11.03,8.017,25.019,24]pentacosa-1(25),2(11),3,5,7,9,12,14,16,19(24),20,22-dodecaen-10-amine |
| SMILES | COc1ccc2c(c1)[nH]c1cc(OC)c3ccc4c(N)nc5ccccc5c4c3c12 |
| InChI | InChI=1S/C25H19N3O2/c1-29-13-7-8-15-19(11-13)27-20-12-21(30-2)16-9-10-17-22(24(16)23(15)20)14-5-3-4-6-18(14)28-25(17)26/h3-12,27H,1-2H3,(H2,26,28) |
| InChIKey | VPBYZWNRIWJNKO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|