C15H20BrFN2O2 — CID 122224391
N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-di(propan-2-yl)oxamide (PubChem CID 122224391) has the molecular formula C15H20BrFN2O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-di(propan-2-yl)oxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-di(propan-2-yl)oxamide |
|---|---|
| PubChem CID | 122224391 |
| Molecular Formula | C15H20BrFN2O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N',N'-di(propan-2-yl)oxamide |
| SMILES | CC(C)N(C(=O)C(=O)NCc1cc(Br)ccc1F)C(C)C |
| InChI | InChI=1S/C15H20BrFN2O2/c1-9(2)19(10(3)4)15(21)14(20)18-8-11-7-12(16)5-6-13(11)17/h5-7,9-10H,8H2,1-4H3,(H,18,20) |
| InChIKey | FWVVRCOKAISIND-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|