C23H31NO — CID 122225055
(2S)-1-benzyl-2-[(2S)-2-phenylmethoxybutyl]piperidine (PubChem CID 122225055) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (2S)-1-benzyl-2-[(2S)-2-phenylmethoxybutyl]piperidine.
| Compound Name | (2S)-1-benzyl-2-[(2S)-2-phenylmethoxybutyl]piperidine |
|---|---|
| PubChem CID | 122225055 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2S)-1-benzyl-2-[(2S)-2-phenylmethoxybutyl]piperidine |
| SMILES | CC[C@@H](C[C@@H]1CCCCN1Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H31NO/c1-2-23(25-19-21-13-7-4-8-14-21)17-22-15-9-10-16-24(22)18-20-11-5-3-6-12-20/h3-8,11-14,22-23H,2,9-10,15-19H2,1H3/t22-,23-/m0/s1 |
| InChIKey | DUOZGPVEBPALMJ-GOTSBHOMSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |