C20H24FNO — CID 125487473
(1R)-2-[(2S)-1-benzylpiperidin-2-yl]-1-(4-fluorophenyl)ethanol (PubChem CID 125487473) has the molecular formula C20H24FNO and a molecular weight of 313.42 g/mol. Its IUPAC name is (1R)-2-[(2S)-1-benzylpiperidin-2-yl]-1-(4-fluorophenyl)ethanol.
| Compound Name | (1R)-2-[(2S)-1-benzylpiperidin-2-yl]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 125487473 |
| Molecular Formula | C20H24FNO |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (1R)-2-[(2S)-1-benzylpiperidin-2-yl]-1-(4-fluorophenyl)ethanol |
| SMILES | O[C@H](C[C@@H]1CCCCN1Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO/c21-18-11-9-17(10-12-18)20(23)14-19-8-4-5-13-22(19)15-16-6-2-1-3-7-16/h1-3,6-7,9-12,19-20,23H,4-5,8,13-15H2/t19-,20+/m0/s1 |
| InChIKey | PRQIBUMQPFFOON-VQTJNVASSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |