C20H21NO4S — CID 122226771
2-ethyl-4-methyl-4-[(4-methylphenyl)sulfonylmethyl]isoquinoline-1,3-dione (PubChem CID 122226771) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-ethyl-4-methyl-4-[(4-methylphenyl)sulfonylmethyl]isoquinoline-1,3-dione.
| Compound Name | 2-ethyl-4-methyl-4-[(4-methylphenyl)sulfonylmethyl]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 122226771 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-ethyl-4-methyl-4-[(4-methylphenyl)sulfonylmethyl]isoquinoline-1,3-dione |
| SMILES | CCN1C(=O)c2ccccc2C(C)(CS(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C20H21NO4S/c1-4-21-18(22)16-7-5-6-8-17(16)20(3,19(21)23)13-26(24,25)15-11-9-14(2)10-12-15/h5-12H,4,13H2,1-3H3 |
| InChIKey | HSIDFBUHMWYPJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|