C25H24BN3O2 — CID 122228649
(3R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-N-methoxy-N-methyl-3-naphthalen-2-ylpropanamide (PubChem CID 122228649) has the molecular formula C25H24BN3O2 and a molecular weight of 409.30 g/mol. Its IUPAC name is (3R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-N-methoxy-N-methyl-3-naphthalen-2-ylpropanamide.
| Compound Name | (3R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-N-methoxy-N-methyl-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 122228649 |
| Molecular Formula | C25H24BN3O2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (3R)-3-(2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-yl)-N-methoxy-N-methyl-3-naphthalen-2-ylpropanamide |
| SMILES | CON(C)C(=O)C[C@@H](B1Nc2cccc3cccc(c23)N1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H24BN3O2/c1-29(31-2)24(30)16-21(20-14-13-17-7-3-4-8-19(17)15-20)26-27-22-11-5-9-18-10-6-12-23(28-26)25(18)22/h3-15,21,27-28H,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZRZHQFBCJOWVBG-OAQYLSRUSA-N |
| XLogP | 5.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|