C29H36N2O5 — CID 140861319
tert-butyl N-[(2S,3S)-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-2-naphthalen-2-yl-3-phenylpropyl]-N-methylcarbamate (PubChem CID 140861319) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-2-naphthalen-2-yl-3-phenylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-2-naphthalen-2-yl-3-phenylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140861319 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-[2-[methoxy(methyl)amino]-2-oxoethoxy]-2-naphthalen-2-yl-3-phenylpropyl]-N-methylcarbamate |
| SMILES | CON(C)C(=O)CO[C@H](c1ccccc1)[C@H](CN(C)C(=O)OC(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H36N2O5/c1-29(2,3)36-28(33)30(4)19-25(24-17-16-21-12-10-11-15-23(21)18-24)27(22-13-8-7-9-14-22)35-20-26(32)31(5)34-6/h7-18,25,27H,19-20H2,1-6H3/t25-,27-/m1/s1 |
| InChIKey | RCZTWAUMWJJVOI-XNMGPUDCSA-N |
| XLogP | 5.57 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|