C24H28N2O2 — CID 118675529
2-[(1S,2S)-3-[ethyl(methyl)amino]-2-naphthalen-2-yl-1-phenylpropoxy]acetamide (PubChem CID 118675529) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(1S,2S)-3-[ethyl(methyl)amino]-2-naphthalen-2-yl-1-phenylpropoxy]acetamide.
| Compound Name | 2-[(1S,2S)-3-[ethyl(methyl)amino]-2-naphthalen-2-yl-1-phenylpropoxy]acetamide |
|---|---|
| PubChem CID | 118675529 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(1S,2S)-3-[ethyl(methyl)amino]-2-naphthalen-2-yl-1-phenylpropoxy]acetamide |
| SMILES | CCN(C)C[C@H](c1ccc2ccccc2c1)[C@H](OCC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-26(2)16-22(21-14-13-18-9-7-8-12-20(18)15-21)24(28-17-23(25)27)19-10-5-4-6-11-19/h4-15,22,24H,3,16-17H2,1-2H3,(H2,25,27)/t22-,24-/m1/s1 |
| InChIKey | TYSDGMNGHJGKJI-ISKFKSNPSA-N |
| XLogP | 4.12 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |