C22H22BrNO2 — CID 118675458
2-bromo-N-[(2R,3R)-3-hydroxy-2-naphthalen-2-yl-3-phenylpropyl]-N-methylacetamide (PubChem CID 118675458) has the molecular formula C22H22BrNO2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 2-bromo-N-[(2R,3R)-3-hydroxy-2-naphthalen-2-yl-3-phenylpropyl]-N-methylacetamide.
| Compound Name | 2-bromo-N-[(2R,3R)-3-hydroxy-2-naphthalen-2-yl-3-phenylpropyl]-N-methylacetamide |
|---|---|
| PubChem CID | 118675458 |
| Molecular Formula | C22H22BrNO2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-bromo-N-[(2R,3R)-3-hydroxy-2-naphthalen-2-yl-3-phenylpropyl]-N-methylacetamide |
| SMILES | CN(C[C@@H](c1ccc2ccccc2c1)[C@@H](O)c1ccccc1)C(=O)CBr |
| InChI | InChI=1S/C22H22BrNO2/c1-24(21(25)14-23)15-20(22(26)17-8-3-2-4-9-17)19-12-11-16-7-5-6-10-18(16)13-19/h2-13,20,22,26H,14-15H2,1H3/t20-,22-/m0/s1 |
| InChIKey | QRFXTRXHCILMQB-UNMCSNQZSA-N |
| XLogP | 4.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|