C54H54N2O4S2 — CID 122229724
2,9-bis[5-(2-ethylhexyl)thiophen-2-yl]-6,13-bis[(E)-2-phenylethenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 122229724) has the molecular formula C54H54N2O4S2 and a molecular weight of 859.17 g/mol. Its IUPAC name is 2,9-bis[5-(2-ethylhexyl)thiophen-2-yl]-6,13-bis[(E)-2-phenylethenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,9-bis[5-(2-ethylhexyl)thiophen-2-yl]-6,13-bis[(E)-2-phenylethenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 122229724 |
| Molecular Formula | C54H54N2O4S2 |
| Molecular Weight | 859.17 g/mol |
| Exact Mass | 858.35 |
| IUPAC Name | 2,9-bis[5-(2-ethylhexyl)thiophen-2-yl]-6,13-bis[(E)-2-phenylethenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCC(CC)Cc1ccc(-c2cc3c4c(c(-c5ccc(CC(CC)CCCC)s5)cc5c4c2C(=O)N(/C=C/c2ccccc2)C5=O)C(=O)N(/C=C/c2ccccc2)C3=O)s1 |
| InChI | InChI=1S/C54H54N2O4S2/c1-5-9-17-35(7-3)31-39-23-25-45(61-39)41-33-43-48-47-44(52(58)55(53(59)49(41)47)29-27-37-19-13-11-14-20-37)34-42(46-26-24-40(62-46)32-36(8-4)18-10-6-2)50(48)54(60)56(51(43)57)30-28-38-21-15-12-16-22-38/h11-16,19-30,33-36H,5-10,17-18,31-32H2,1-4H3/b29-27+,30-28+ |
| InChIKey | MRHUCLKHFHRCIF-QAVVBOBSSA-N |
| XLogP | 14.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.17 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|