C20H19NO3 — CID 122230000
N-(2-methoxyphenyl)-1-[(E)-3-phenylprop-2-enoyl]cyclopropane-1-carboxamide (PubChem CID 122230000) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-[(E)-3-phenylprop-2-enoyl]cyclopropane-1-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-1-[(E)-3-phenylprop-2-enoyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 122230000 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(2-methoxyphenyl)-1-[(E)-3-phenylprop-2-enoyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19NO3/c1-24-17-10-6-5-9-16(17)21-19(23)20(13-14-20)18(22)12-11-15-7-3-2-4-8-15/h2-12H,13-14H2,1H3,(H,21,23)/b12-11+ |
| InChIKey | DMMHFZNTXXJDNR-VAWYXSNFSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|