C13H14N2O2 — CID 78994745
1-cyano-N-(2-methoxyphenyl)cyclobutane-1-carboxamide (PubChem CID 78994745) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-cyano-N-(2-methoxyphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-N-(2-methoxyphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 78994745 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-cyano-N-(2-methoxyphenyl)cyclobutane-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1(C#N)CCC1 |
| InChI | InChI=1S/C13H14N2O2/c1-17-11-6-3-2-5-10(11)15-12(16)13(9-14)7-4-8-13/h2-3,5-6H,4,7-8H2,1H3,(H,15,16) |
| InChIKey | IPJWPACAOLVVMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |