C19H25FO6 — CID 122232686
1,3-dimethoxypropan-2-yl 3-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-fluorophenyl]propanoate (PubChem CID 122232686) has the molecular formula C19H25FO6 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1,3-dimethoxypropan-2-yl 3-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-fluorophenyl]propanoate.
| Compound Name | 1,3-dimethoxypropan-2-yl 3-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 122232686 |
| Molecular Formula | C19H25FO6 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1,3-dimethoxypropan-2-yl 3-[2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-fluorophenyl]propanoate |
| SMILES | CCOC(=O)/C=C/c1cc(F)ccc1CCC(=O)OC(COC)COC |
| InChI | InChI=1S/C19H25FO6/c1-4-25-18(21)9-7-15-11-16(20)8-5-14(15)6-10-19(22)26-17(12-23-2)13-24-3/h5,7-9,11,17H,4,6,10,12-13H2,1-3H3/b9-7+ |
| InChIKey | OHCOLJUYDBBOFP-VQHVLOKHSA-N |
| XLogP | 2.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|