C11H20F2OSi — CID 122232932
(8,8-difluoro-1-bicyclo[5.1.0]octanyl)oxy-trimethylsilane (PubChem CID 122232932) has the molecular formula C11H20F2OSi and a molecular weight of 234.36 g/mol. Its IUPAC name is (8,8-difluoro-1-bicyclo[5.1.0]octanyl)oxy-trimethylsilane.
| Compound Name | (8,8-difluoro-1-bicyclo[5.1.0]octanyl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 122232932 |
| Molecular Formula | C11H20F2OSi |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (8,8-difluoro-1-bicyclo[5.1.0]octanyl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC12CCCCCC1C2(F)F |
| InChI | InChI=1S/C11H20F2OSi/c1-15(2,3)14-10-8-6-4-5-7-9(10)11(10,12)13/h9H,4-8H2,1-3H3 |
| InChIKey | UMJHUMBYFLDBPH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|