C10H18F2OSi — CID 129406248
[(1R,6S)-7,7-difluoro-1-bicyclo[4.1.0]heptanyl]oxy-trimethylsilane (PubChem CID 129406248) has the molecular formula C10H18F2OSi and a molecular weight of 220.33 g/mol. Its IUPAC name is [(1R,6S)-7,7-difluoro-1-bicyclo[4.1.0]heptanyl]oxy-trimethylsilane.
| Compound Name | [(1R,6S)-7,7-difluoro-1-bicyclo[4.1.0]heptanyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 129406248 |
| Molecular Formula | C10H18F2OSi |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | [(1R,6S)-7,7-difluoro-1-bicyclo[4.1.0]heptanyl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@]12CCCC[C@@H]1C2(F)F |
| InChI | InChI=1S/C10H18F2OSi/c1-14(2,3)13-9-7-5-4-6-8(9)10(9,11)12/h8H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | FHMLYELMNGPMDP-DTWKUNHWSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|