C13H26OSi — CID 135015623
trimethyl-[[(1R,6S,7S)-7-propan-2-yl-1-bicyclo[4.1.0]heptanyl]oxy]silane (PubChem CID 135015623) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is trimethyl-[[(1R,6S,7S)-7-propan-2-yl-1-bicyclo[4.1.0]heptanyl]oxy]silane.
| Compound Name | trimethyl-[[(1R,6S,7S)-7-propan-2-yl-1-bicyclo[4.1.0]heptanyl]oxy]silane |
|---|---|
| PubChem CID | 135015623 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | trimethyl-[[(1R,6S,7S)-7-propan-2-yl-1-bicyclo[4.1.0]heptanyl]oxy]silane |
| SMILES | CC(C)[C@H]1[C@@H]2CCCC[C@@]21O[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-10(2)12-11-8-6-7-9-13(11,12)14-15(3,4)5/h10-12H,6-9H2,1-5H3/t11-,12-,13+/m0/s1 |
| InChIKey | USMSTWKTQCOPCJ-RWMBFGLXSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|