C20H19NO — CID 122234830
9-methoxy-5-phenyl-1,2,3,4-tetrahydrobenzo[h]quinoline (PubChem CID 122234830) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 9-methoxy-5-phenyl-1,2,3,4-tetrahydrobenzo[h]quinoline.
| Compound Name | 9-methoxy-5-phenyl-1,2,3,4-tetrahydrobenzo[h]quinoline |
|---|---|
| PubChem CID | 122234830 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 9-methoxy-5-phenyl-1,2,3,4-tetrahydrobenzo[h]quinoline |
| SMILES | COc1ccc2cc(-c3ccccc3)c3c(c2c1)NCCC3 |
| InChI | InChI=1S/C20H19NO/c1-22-16-10-9-15-12-18(14-6-3-2-4-7-14)17-8-5-11-21-20(17)19(15)13-16/h2-4,6-7,9-10,12-13,21H,5,8,11H2,1H3 |
| InChIKey | VRXUJXBAJPWABC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |